Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Resorcinol Sulfoxide |
|---|---|
| Synonyms | 2-(2,6-Dihydroxyphenyl)Sulfinylresorcinol; 4,4'-Sulphinyldiresorcinol |
| Molecular Structure |  |
| Molecular Formula | C12H10O5S |
| Molecular Weight | 266.27 |
| CAS Registry Number | 26948-96-9 |
| EINECS | 248-129-3 |
| SMILES | C1=C(C(=C(C=C1)O)[S](C2=C(C=CC=C2O)O)=O)O |
| InChI | 1S/C12H10O5S/c13-7-3-1-4-8(14)11(7)18(17)12-9(15)5-2-6-10(12)16/h1-6,13-16H |
| InChIKey | WUDPYTUCYMDYKB-UHFFFAOYSA-N |
| Density | 1.785g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.042°C at 760 mmHg (Cal.) |
| Flash point | 293.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Resorcinol Sulfoxide |