Online Database of Chemicals from Around the World
|
CAS#: 27038-40-0 Product: 7-Methylpsoralen No suppilers available for the product. |
| Name | 7-Methylpsoralen |
|---|---|
| Synonyms | 4-Methyl-7-Furo[2,3-F]Chromenone; 7-Meap; 7-Methyl-Allo-Psoralen |
| Molecular Structure |  |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 27038-40-0 |
| SMILES | C3=C1OC(=O)C=CC1=C2OC=CC2=C3C |
| InChI | 1S/C12H8O3/c1-7-6-10-9(2-3-11(13)15-10)12-8(7)4-5-14-12/h2-6H,1H3 |
| InChIKey | FHFUKDRNORDLDL-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.603°C at 760 mmHg (Cal.) |
| Flash point | 183.378°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methylpsoralen |