Online Database of Chemicals from Around the World
|
CAS#: 27038-42-2 Product: 4,7-Dimethylallopsoralen No suppilers available for the product. |
| Name | 4,7-Dimethylallopsoralen |
|---|---|
| Synonyms | 4,9-Dimethylpyrano[6,5-G]Benzofuran-7-One; 4,9-Dimethyl-7-Pyrano[6,5-G]Benzofuranone; 4,7-Dimethylallopsoralen |
| Molecular Structure |  |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 27038-42-2 |
| SMILES | C3=C1OC(=O)C=C(C)C1=C2OC=CC2=C3C |
| InChI | 1S/C13H10O3/c1-7-5-10-12(8(2)6-11(14)16-10)13-9(7)3-4-15-13/h3-6H,1-2H3 |
| InChIKey | APBGHVVHKDULJA-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.609°C at 760 mmHg (Cal.) |
| Flash point | 185.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dimethylallopsoralen |