|
CAS#: 271247-57-5 Product: 1-(4-Pyridyl)-2-[3-(Trifluoromethyl)Phenyl]Ethane-1,2-Dione No suppilers available for the product. |
| Name | 1-(4-Pyridyl)-2-[3-(Trifluoromethyl)Phenyl]Ethane-1,2-Dione |
|---|---|
| Synonyms | 1,2-ETHAN |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8F3NO2 |
| Molecular Weight | 279.21 |
| CAS Registry Number | 271247-57-5 |
| SMILES | O=C(C(=O)c1cccc(c1)C(F)(F)F)c2ccncc2 |
| InChI | 1S/C14H8F3NO2/c15-14(16,17)11-3-1-2-10(8-11)13(20)12(19)9-4-6-18-7-5-9/h1-8H |
| InChIKey | CCOMNKIIKQMDQD-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.876°C at 760 mmHg (Cal.) |
| Flash point | 185.357°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Pyridyl)-2-[3-(Trifluoromethyl)Phenyl]Ethane-1,2-Dione |