Online Database of Chemicals from Around the World
2-(2-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol
[CAS# 2713-62-4]
Identification| Name | 2-(2-Aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 |
| CAS Registry Number | 2713-62-4 |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)(C(F)(F)F)O)N |
|
Properties
| Solubility | 541.5 mg/L (25 °C water) |
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.455, Calc.* |
| Melting point | 59.37 °C |
| Boiling Point | 251.41 °C, 288.9±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 128.5±27.3 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products