Online Database of Chemicals from Around the World
|
CAS#: 27165-88-4 Product: Tetracyclo[6.6.2.1(3,13).1(6,10)]Octadeca-1,3(17),6,8,10(18),13-Hexaene No suppilers available for the product. |
| Name | Tetracyclo[6.6.2.1(3,13).1(6,10)]Octadeca-1,3(17),6,8,10(18),13-Hexaene |
|---|---|
| Synonyms | [2.2.2](1,3,5)Cyclophane; (2.2.2)(1,3,5)Cyclophane |
| Molecular Structure | ![CAS#: 27165-88-4， Tetracyclo[6.6.2.1(3,13).1(6,10)]Octadeca-1,3(17),6,8,10(18),13-Hexaene](/moreStructures/27165-88-4.gif) |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 27165-88-4 |
| SMILES | C3C1=CC4=CC(=C1)CCC2=CC(=CC(=C2)C3)CC4 |
| InChI | 1S/C18H18/c1-2-14-9-17-5-3-15-7-13(1)8-16(11-15)4-6-18(10-14)12-17/h7-12H,1-6H2 |
| InChIKey | KGQZPENLTBITEJ-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.69°C at 760 mmHg (Cal.) |
| Flash point | 178.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetracyclo[6.6.2.1(3,13).1(6,10)]Octadeca-1,3(17),6,8,10(18),13-Hexaene |