Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Diethyl Pyrophosphate |
|---|---|
| Synonyms | (Ethoxy-Hydroxy-Phosphoryl) Ethyl Hydrogen Phosphate; Ethyl Pyrophosphate; Nsc70156 |
| Molecular Structure |  |
| Molecular Formula | C4H12O7P2 |
| Molecular Weight | 234.08 |
| CAS Registry Number | 27194-63-4 |
| EINECS | 248-314-9 |
| SMILES | C(O[P](O[P](OCC)(O)=O)(O)=O)C |
| InChI | 1S/C4H12O7P2/c1-3-9-12(5,6)11-13(7,8)10-4-2/h3-4H2,1-2H3,(H,5,6)(H,7,8) |
| InChIKey | RUZMUTWCUZLWQU-UHFFFAOYSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.244°C at 760 mmHg (Cal.) |
| Flash point | 157.155°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl Pyrophosphate |