Online Database of Chemicals from Around the World
|
CAS#: 2734-13-6 Product: 9,10-Dihydro-9,10-ethenoanthracene No suppilers available for the product. |
| Name | 9,10-Dihydro-9,10-ethenoanthracene |
|---|---|
| Synonyms | Inchi=1/C16h12/C1-2-6-12-11(5-1)15-9-10-16(12)14-8-4-3-7-13(14)15/H1-10,15-16; 9,10-Dihydro-9,10-Ethenoanthracene; 9,10-Ethenoanthracene, 9,10-Dihydro- |
| Molecular Structure |  |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 2734-13-6 |
| SMILES | C3=C2C4C1=CC=CC=C1C(C2=CC=C3)C=C4 |
| InChI | 1S/C16H12/c1-2-6-12-11(5-1)15-9-10-16(12)14-8-4-3-7-13(14)15/h1-10,15-16H |
| InChIKey | VWDKVBGOVYWYFZ-UHFFFAOYSA-N |
| Density | 1.162g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.56°C at 760 mmHg (Cal.) |
| Flash point | 155.51°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-9,10-ethenoanthracene |