| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | O-Phospho-DL-Threonine |
| Synonyms | 2-Amino-3-Phosphonooxy-Butanoic Acid; 2-Amino-3-Phosphonooxy-Butyric Acid; O-Phospho-L-Threonine |
| Molecular Structure | ![]() |
| Molecular Formula | C4H10NO6P |
| Molecular Weight | 199.10 |
| CAS Registry Number | 27530-80-9 |
| EINECS | 248-512-5 |
| SMILES | CC(O[P](O)(O)=O)C(C(O)=O)N |
| InChI | 1S/C4H10NO6P/c1-2(3(5)4(6)7)11-12(8,9)10/h2-3H,5H2,1H3,(H,6,7)(H2,8,9,10) |
| InChIKey | USRGIUJOYOXOQJ-UHFFFAOYSA-N |
| Density | 1.671g/cm3 (Cal.) |
|---|---|
| Melting point | 184°C (Expl.) |
| Boiling point | 454.004°C at 760 mmHg (Cal.) |
| Flash point | 228.374°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for O-Phospho-DL-Threonine |