| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3R,4S,5R)-5-(Hydroxymethyl)-3,4-Piperidinediol |
|---|---|
| Synonyms | (3R,4S,5R)-5-(Hydroxymethyl)piperidine-3,4-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 |
| CAS Registry Number | 275363-99-0 |
| SMILES | C1[C@@H]([C@@H]([C@@H](CN1)O)O)CO |
| InChI | 1S/C6H13NO3/c8-3-4-1-7-2-5(9)6(4)10/h4-10H,1-3H2/t4-,5-,6+/m1/s1 |
| InChIKey | QPYJXFZUIJOGNX-PBXRRBTRSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.2±37.0°C at 760 mmHg (Cal.) |
| Flash point | 171.8±17.1°C (Cal.) |
| Refractive index | 1.535 (Cal.) |
| (1) | Y. Suman Reddy, Pavan K. Kancharla, Rashmi Roy and Yashwant D. Vankar. Aza-Claisen rearrangement of 2-C-hydroxymethyl glycals as a versatile strategy towards synthesis of isofagomine and related biologically important azasugars, Org. Biomol. Chem., 2012, 10, 2760. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3R,4S,5R)-5-(Hydroxymethyl)-3,4-Piperidinediol |