Online Database of Chemicals from Around the World
|
CAS#: 27542-23-0 Product: Erioflorin Acetate No suppilers available for the product. |
| Name | Erioflorin Acetate |
|---|---|
| Synonyms | Nsc251667; Nci60_002009; 2-Propenoic Acid, 2-Methyl-, 3-(Acetyloxy)-1A,2,3,5A,7,8,8A,9,10,10A-Decahydro-4,10A-Dimethyl-8-Methylene-7-Oxooxireno(5,6)Cyclodeca(1,2-B)Furan-9-Yl Ester, (1Ar-(1Ar*,3S*,4E,5Ar*,8Ar*,9R*,10As*))- |
| Molecular Structure |  |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 |
| CAS Registry Number | 27542-23-0 |
| SMILES | CC13OC1CC(OC(=O)C)C(=C/C2OC(=O)C(C2C(OC(=O)C(=C)C)C3)=C)/C |
| InChI | 1S/C21H26O7/c1-10(2)19(23)27-16-9-21(6)17(28-21)8-14(25-13(5)22)11(3)7-15-18(16)12(4)20(24)26-15/h7,14-18H,1,4,8-9H2,2-3,5-6H3/b11-7+ |
| InChIKey | RXIZKFBTUOTBOZ-YRNVUSSQSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.059°C at 760 mmHg (Cal.) |
| Flash point | 226.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Erioflorin Acetate |