Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (1-Methyl-1-Phenylethyl)-Phenol |
|---|---|
| Synonyms | 3-(1-Methyl-1-Phenyl-Ethyl)Phenol; 3-(1-Methyl-1-Phenylethyl)Phenol; (1-Methyl-1-Phenylethyl)Phenol |
| Molecular Structure |  |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 |
| CAS Registry Number | 27576-86-9 |
| EINECS | 248-539-2 |
| SMILES | C1=C(C=CC=C1O)C(C)(C)C2=CC=CC=C2 |
| InChI | 1S/C15H16O/c1-15(2,12-7-4-3-5-8-12)13-9-6-10-14(16)11-13/h3-11,16H,1-2H3 |
| InChIKey | PARGHORKDQHVPM-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.547°C at 760 mmHg (Cal.) |
| Flash point | 159.434°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Methyl-1-Phenylethyl)-Phenol |