Online Database of Chemicals from Around the World
|
CAS#: 27599-04-8 Product: Bis(alpha-Chlorotolyl) Ether No suppilers available for the product. |
| Name | Bis(alpha-Chlorotolyl) Ether |
|---|---|
| Synonyms | 1-Chloro-4-[(4-Chlorobenzyl)Oxymethyl]Benzene; 1,1'-(Oxybis(Methylene))Bis(4-Chlorobenzene); Bis(P-Chlorobenzyl) Ether |
| Molecular Structure |  |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.15 |
| CAS Registry Number | 27599-04-8 (56428-00-3) |
| EINECS | 248-556-5 |
| SMILES | C1=CC(=CC=C1Cl)COCC2=CC=C(C=C2)Cl |
| InChI | 1S/C14H12Cl2O/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8H,9-10H2 |
| InChIKey | REXQTRHCVRPOMB-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.653°C at 760 mmHg (Cal.) |
| Flash point | 92.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(alpha-Chlorotolyl) Ether |