|
CAS#: 27619-89-2 Product: 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonyl Chloride No suppilers available for the product. |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonyl Chloride |
|---|---|
| Synonyms | 1-Octanesulfonyl Chloride, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-; 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4ClF13O2S |
| Molecular Weight | 446.61 |
| CAS Registry Number | 27619-89-2 |
| EINECS | 248-576-4 |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C[S](=O)(=O)Cl |
| InChI | 1S/C8H4ClF13O2S/c9-25(23,24)2-1-3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)22/h1-2H2 |
| InChIKey | NDBZVZPOTNLWLU-UHFFFAOYSA-N |
| Density | 1.691g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.763°C at 760 mmHg (Cal.) |
| Flash point | 97.596°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonyl Chloride |