Online Database of Chemicals from Around the World
|
CAS#: 27646-47-5 Product: Rubratoxin B Triacetate No suppilers available for the product. |
| Name | Rubratoxin B Triacetate |
|---|---|
| Synonyms | Rubratoxin B, Triacetate |
| Molecular Structure |  |
| Molecular Formula | C32H36O14 |
| Molecular Weight | 644.63 |
| CAS Registry Number | 27646-47-5 |
| SMILES | [C@@H]1(OC(=O)C)C(C4=C(CC(CC2=C1C(OC2=O)=O)[C@H](OC(=O)C)C3OC(=O)C=CC3)C(OC4=O)=O)[C@H](OC(=O)C)CCCCCC |
| InChI | 1S/C32H36O14/c1-5-6-7-8-10-21(41-15(2)33)26-24-19(29(37)45-31(24)39)13-18(27(42-16(3)34)22-11-9-12-23(36)44-22)14-20-25(28(26)43-17(4)35)32(40)46-30(20)38/h9,12,18,21-22,26-28H,5-8,10-11,13-14H2,1-4H3/t18?,21-,22?,26?,27+,28+/m1/s1 |
| InChIKey | RLPCKDQGNOVADL-XZJZCARSSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 799.043°C at 760 mmHg (Cal.) |
| Flash point | 328.507°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rubratoxin B Triacetate |