|
CAS#: 277-10-1 Product: Cubane No suppilers available for the product. |
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Cyclic hydrocarbon |
|---|---|
| Name | Cubane |
| Synonyms | Chebi:33014; Pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]Octane; Inchi=1/C8h8/C1-2-5-3(1)7-4(1)6(2)8(5)7/H1-8 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8 |
| Molecular Weight | 104.15 |
| CAS Registry Number | 277-10-1 |
| SMILES | C12C3C4C1C5C2C3C45 |
| InChI | 1S/C8H8/c1-2-5-3(1)7-4(1)6(2)8(5)7/h1-8H |
| InChIKey | TXWRERCHRDBNLG-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 125-126°C (Expl.) |
| Boiling point | 137.9±7.0°C at 760 mmHg (Cal.) |
| Flash point | 7.6±11.7°C (Cal.) |
| Safety Description | Treat as potentially harmful. |
|---|---|
| (1) | Armida Torreggiani and Anna Tinti. Raman spectroscopy a promising technique for investigations of metallothioneins, Metallomics, 2010, 2, 246. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Cubane |