| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Fast Red B Salt |
|---|---|
| Synonyms | 2-Methoxy-4-Nitro-Benzenediazonium; Benzenediazonium, 2-Methoxy-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N3O3 |
| Molecular Weight | 180.14 |
| CAS Registry Number | 27761-26-8 |
| EINECS | 248-642-2 |
| SMILES | C1=C(C(=CC=C1[N+](=O)[O-])[N+]#N)OC |
| InChI | 1S/C7H6N3O3/c1-13-7-4-5(10(11)12)2-3-6(7)9-8/h2-4H,1H3/q+1 |
| InChIKey | QCONCWPZAHEPSP-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Fast Red B Salt |