|
CAS#: 27766-21-8 Product: N'',N'''-Di-2(1H)-Naphthalenylidenethiocarbonohydrazide No suppilers available for the product. |
| Name | N'',N'''-Di-2(1H)-Naphthalenylidenethiocarbonohydrazide |
|---|---|
| Synonyms | 2 (1H)-Naphthalenone, thiocarbohydrazone; di-2-naphthylthiocarbazone; NSC140014 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18N4S |
| Molecular Weight | 358.46 |
| CAS Registry Number | 27766-21-8 |
| SMILES | S=C(NN=C2/C=C\c1ccccc1C2)NN=C4/C=C\c3c(cccc3)C4 |
| InChI | 1S/C21H18N4S/c26-21(24-22-19-11-9-15-5-1-3-7-17(15)13-19)25-23-20-12-10-16-6-2-4-8-18(16)14-20/h1-12H,13-14H2,(H2,24,25,26) |
| InChIKey | NVRNVDLEMWZIJG-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.757°C at 760 mmHg (Cal.) |
| Flash point | 290.516°C (Cal.) |
| Refractive index | 1.691 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'',N'''-Di-2(1H)-Naphthalenylidenethiocarbonohydrazide |