Online Database of Chemicals from Around the World
| Name | Butyl 3-(Dimethylamino)-4-Phenylbutanoate |
|---|---|
| Synonyms | Butyl 3-(dimethylamino)-4-phenylbutanoate # |
| Molecular Structure |  |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 |
| CAS Registry Number | 27820-09-3 |
| SMILES | O=C(OCCCC)CC(N(C)C)Cc1ccccc1 |
| InChI | 1S/C16H25NO2/c1-4-5-11-19-16(18)13-15(17(2)3)12-14-9-7-6-8-10-14/h6-10,15H,4-5,11-13H2,1-3H3 |
| InChIKey | JTYCJYGPWVVWOS-UHFFFAOYSA-N |
| Density | 0.992g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.398°C at 760 mmHg (Cal.) |
| Flash point | 112.585°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl 3-(Dimethylamino)-4-Phenylbutanoate |
