Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (2,6-Dimethoxyphenyl)lithium |
|---|---|
| Synonyms | (2,6-Dimethoxyphenyl)Lithium |
| Molecular Structure |  |
| Molecular Formula | C8H9LiO2 |
| Molecular Weight | 144.10 |
| CAS Registry Number | 2785-97-9 |
| EINECS | 220-502-5 |
| SMILES | [C-]1=C(OC)C=CC=C1OC.[Li+] |
| InChI | 1S/C8H9O2.Li/c1-9-7-4-3-5-8(6-7)10-2;/h3-5H,1-2H3;/q-1;+1 |
| InChIKey | SYTLRIRYZMOMIO-UHFFFAOYSA-N |
| Boiling point | 217.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 87.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dimethoxyphenyl)lithium |