| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic acid halide |
|---|---|
| Name | Pentafluorobenzenesulfenyl Chloride |
| Synonyms | Thiohypochlorous Acid (2,3,4,5,6-Pentafluorophenyl) Ester; Pentafluorobenzenesulphenyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6ClF5S |
| Molecular Weight | 234.57 |
| CAS Registry Number | 27918-31-6 |
| EINECS | 248-727-4 |
| SMILES | C1(=C(C(=C(F)C(=C1F)F)F)F)SCl |
| InChI | 1S/C6ClF5S/c7-13-6-4(11)2(9)1(8)3(10)5(6)12 |
| InChIKey | ILZYHMZOLCNNCP-UHFFFAOYSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 210.089°C at 760 mmHg (Cal.) |
| Flash point | 80.859°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentafluorobenzenesulfenyl Chloride |