Online Database of Chemicals from Around the World
|
CAS#: 27920-25-8 Product: (2-Biphenylyloxy)Methanol No suppilers available for the product. |
| Name | (2-Biphenylyloxy)Methanol |
|---|---|
| Synonyms | (2-Biphenylyloxy)Methanol; 2-(Hydroxymethoxy)-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 27920-25-8 |
| EINECS | 248-729-5 |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=C2)OCO |
| InChI | 1S/C13H12O2/c14-10-15-13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | PRDSJPMVXYYZQU-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.909°C at 760 mmHg (Cal.) |
| Flash point | 146.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Biphenylyloxy)Methanol |