Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Butyl 4-Chlorobenzoate |
|---|---|
| Synonyms | 4-Chlorobenzoic Acid Butyl Ester; 4-Chlorobenzoic Acid, Butyl Ester; Benzoic Acid, 4-Chloro-, Butyl Ester |
| Molecular Structure |  |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 |
| CAS Registry Number | 27942-64-9 |
| SMILES | C1=C(C(=O)OCCCC)C=CC(=C1)Cl |
| InChI | 1S/C11H13ClO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7H,2-3,8H2,1H3 |
| InChIKey | PBPVJPWUWLGOEC-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.095°C at 760 mmHg (Cal.) |
| Flash point | 126.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl 4-Chlorobenzoate |