Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S)-2-(4-Fluorophenyl)Propanal |
|---|---|
| Synonyms | (S)-2-(4-fluorophenyl)propanal |
| Molecular Structure |  |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.17 |
| CAS Registry Number | 279683-49-7 |
| SMILES | C[C@H](C=O)C1=CC=C(C=C1)F |
| InChI | 1S/C9H9FO/c1-7(6-11)8-2-4-9(10)5-3-8/h2-7H,1H3/t7-/m1/s1 |
| InChIKey | AANCPBXTNIZNIJ-SSDOTTSWSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 204.6±15.0°C at 760 mmHg (Cal.) |
| Flash point | 84.1±10.6°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(4-Fluorophenyl)Propanal |