Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(2,5-Diethylphenyl)Ethanone |
|---|---|
| Synonyms | 2,5-Diethylacetophenone; Ethanone, 1-(2,5-Diethylphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 2797-80-0 |
| SMILES | C1=C(C=C(C(=C1)CC)C(=O)C)CC |
| InChI | 1S/C12H16O/c1-4-10-6-7-11(5-2)12(8-10)9(3)13/h6-8H,4-5H2,1-3H3 |
| InChIKey | XCNCPXSQWCEGBQ-UHFFFAOYSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.032°C at 760 mmHg (Cal.) |
| Flash point | 114.791°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,5-Diethylphenyl)Ethanone |