Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Ethylcoumarin |
|---|---|
| Synonyms | 6-Ethyl-2-Chromenone; 6-Ethylcoumarin; Nci60_041631 |
| Molecular Structure |  |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 28045-77-4 |
| EINECS | 248-796-0 |
| SMILES | C1=C2C(=CC(=C1)CC)C=CC(O2)=O |
| InChI | 1S/C11H10O2/c1-2-8-3-5-10-9(7-8)4-6-11(12)13-10/h3-7H,2H2,1H3 |
| InChIKey | SBZIILXFKTXDCJ-UHFFFAOYSA-N |
| Density | 1.162g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.237°C at 760 mmHg (Cal.) |
| Flash point | 133.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethylcoumarin |