Online Database of Chemicals from Around the World
|
CAS#: 28116-92-9 Product: beta-Methylnorleucine No suppilers available for the product. |
| Name | beta-Methylnorleucine |
|---|---|
| Synonyms | (2S,3S)-2-Amino-3-Methyl-Hexanoic Acid; L-Norleucine, 3-Methyl-, Erythro-; Beta-Methylnorleucine |
| Molecular Structure |  |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 |
| CAS Registry Number | 28116-92-9 |
| SMILES | [C@H](C(=O)O)(N)[C@H](CCC)C |
| InChI | 1S/C7H15NO2/c1-3-4-5(2)6(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-,6-/m0/s1 |
| InChIKey | KWSUGULOZFMUDH-WDSKDSINSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.412°C at 760 mmHg (Cal.) |
| Flash point | 101.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Methylnorleucine |