Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-[2-(Ethoxymethyl)-5-Phenyl-3-Furyl]Ethanone |
|---|---|
| Synonyms | 1-(2-(ETHOXYMETHYL)-5-PHENYLFURAN-3-YL)ETHANONE; 1-[2-(Ethoxymethyl)-5-phenyl-3-furyl]ethanon; 1-[2-(Ethoxymethyl)-5-phenyl-3-furyl]ethanone |
| Molecular Structure | ![CAS#: 281198-94-5， 1-[2-(Ethoxymethyl)-5-Phenyl-3-Furyl]Ethanone](/moreStructures/281198-94-5.gif) |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 281198-94-5 |
| SMILES | CCOCc1c(cc(o1)c2ccccc2)C(=O)C |
| InChI | 1S/C15H16O3/c1-3-17-10-15-13(11(2)16)9-14(18-15)12-7-5-4-6-8-12/h4-9H,3,10H2,1-2H3 |
| InChIKey | NEVFBTKHLQIXTO-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 174.9±27.9°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(Ethoxymethyl)-5-Phenyl-3-Furyl]Ethanone |