Online Database of Chemicals from Around the World
| Name | 1,7-Diaminophenazine |
|---|---|
| Synonyms | (7-Aminophenazin-1-Yl)Amine; 1,7-Phenazinediamine; Brn 0176445 |
| Molecular Structure |  |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 |
| CAS Registry Number | 28124-29-0 |
| SMILES | C2=C(N)C=CC3=NC1=C(N)C=CC=C1N=C23 |
| InChI | 1S/C12H10N4/c13-7-4-5-9-11(6-7)15-10-3-1-2-8(14)12(10)16-9/h1-6H,13-14H2 |
| InChIKey | FRPNYDRHOLAYDZ-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.689°C at 760 mmHg (Cal.) |
| Flash point | 298.52°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Diaminophenazine |
