Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2-Dimethyl-4-Phenylsulfanylbenzene |
|---|---|
| Synonyms | 1,2-Dimethyl-4-Phenylsulfanyl-Benzene; 1,2-Dimethyl-4-(Phenylthio)Benzene; Benzene,1,2-Dimethyl-4-(Phenylthio)- |
| Molecular Structure |  |
| Molecular Formula | C14H14S |
| Molecular Weight | 214.32 |
| CAS Registry Number | 2828-65-1 |
| SMILES | C2=C(SC1=CC(=C(C=C1)C)C)C=CC=C2 |
| InChI | 1S/C14H14S/c1-11-8-9-14(10-12(11)2)15-13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | DQKRXXSKBKKHQE-UHFFFAOYSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.623°C at 760 mmHg (Cal.) |
| Flash point | 150.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethyl-4-Phenylsulfanylbenzene |