Online Database of Chemicals from Around the World
|
CAS#: 28338-29-6 Product: (3-Tert-Butylphenyl) Carbamate No suppilers available for the product. |
| Name | (3-Tert-Butylphenyl) Carbamate |
|---|---|
| Synonyms | Carbamic Acid (3-Tert-Butylphenyl) Ester; Phenol, M-Tert-Butyl-, Carbamate; M-Tert-Butylphenol Carbamate |
| Molecular Structure |  |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 |
| CAS Registry Number | 28338-29-6 |
| SMILES | C1=C(C=CC=C1OC(N)=O)C(C)(C)C |
| InChI | 1S/C11H15NO2/c1-11(2,3)8-5-4-6-9(7-8)14-10(12)13/h4-7H,1-3H3,(H2,12,13) |
| InChIKey | JWSPGCGMDZWYHQ-UHFFFAOYSA-N |
| Density | 1.068g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.79°C at 760 mmHg (Cal.) |
| Flash point | 137.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3-Tert-Butylphenyl) Carbamate |