|
CAS#: 2835-61-2 Product: Solvent Brown 3 No suppilers available for the product. |
| Name | Solvent Brown 3 |
|---|---|
| Synonyms | 4-(1-Naphthylazo)Naphthalen-1-Amine; 4-(1-Naphthylazo)-1-Naphthalenamine; [4-(1-Naphthylazo)-1-Naphthyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 |
| CAS Registry Number | 2835-61-2 |
| EINECS | 220-611-8 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2)N=NC4=C3C=CC=CC3=C(C=C4)N |
| InChI | 1S/C20H15N3/c21-18-12-13-20(17-10-4-3-9-16(17)18)23-22-19-11-5-7-14-6-1-2-8-15(14)19/h1-13H,21H2 |
| InChIKey | SILZUVHOJDAKAS-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.047°C at 760 mmHg (Cal.) |
| Flash point | 278.596°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Solvent Brown 3 |