Online Database of Chemicals from Around the World
|
CAS#: 28396-75-0 Product: 4-Methoxydalbergione No suppilers available for the product. |
| Name | 4-Methoxydalbergione |
|---|---|
| Synonyms | 2-Methoxy-5-(1-Phenylprop-2-Enyl)-1,4-Benzoquinone; 2-Methoxy-5-(1-Phenylprop-2-Enyl)-P-Benzoquinone; 2-Methoxy-5-(1-Phenyl-2-Propenyl)Benzo-1,4-Quinone |
| Molecular Structure |  |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 28396-75-0 |
| SMILES | C2=C(C(C1=CC(=O)C(=CC1=O)OC)C=C)C=CC=C2 |
| InChI | 1S/C16H14O3/c1-3-12(11-7-5-4-6-8-11)13-9-15(18)16(19-2)10-14(13)17/h3-10,12H,1H2,2H3 |
| InChIKey | RGSUZUQISVAJJF-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.677°C at 760 mmHg (Cal.) |
| Flash point | 175.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxydalbergione |