Online Database of Chemicals from Around the World
|
CAS#: 28434-86-8 Product: 3,3-Dichloro-4,4-diaminodiphenylether No suppilers available for the product. |
| Name | 3,3-Dichloro-4,4-diaminodiphenylether |
|---|---|
| Synonyms | 4-(4-Amino-3-Chloro-Phenoxy)-2-Chloro-Aniline; [4-(4-Amino-3-Chloro-Phenoxy)-2-Chloro-Phenyl]Amine; 4,4'-Oxybis(2-Chlorobenzenamine) |
| Molecular Structure |  |
| Molecular Formula | C12H10Cl2N2O |
| Molecular Weight | 269.13 |
| CAS Registry Number | 28434-86-8 |
| SMILES | C1=CC(=CC(=C1N)Cl)OC2=CC(=C(C=C2)N)Cl |
| InChI | 1S/C12H10Cl2N2O/c13-9-5-7(1-3-11(9)15)17-8-2-4-12(16)10(14)6-8/h1-6H,15-16H2 |
| InChIKey | IVVWBIJMWBNKFV-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.354°C at 760 mmHg (Cal.) |
| Flash point | 202.58°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dichloro-4,4-diaminodiphenylether |