Online Database of Chemicals from Around the World
|
CAS#: 28452-93-9 Product: Sulfolene No suppilers available for the product. |
| Name | Sulfolene |
|---|---|
| Synonyms | 2,5-Dihydrothiophene-1,1-Dioxide; Inchi=1/C4h6o2s/C5-7(6)3-1-2-4-7/H1-2H,3-4H; Thiophene, Dihydro-, 1,1-Dioxide |
| Molecular Structure |  |
| Molecular Formula | C4H6O2S |
| Molecular Weight | 118.15 |
| CAS Registry Number | 28452-93-9 |
| SMILES | O=[S]1(CC=CC1)=O |
| InChI | 1S/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| InChIKey | MBDNRNMVTZADMQ-UHFFFAOYSA-N |
| Density | 1.314 (Expl.) |
|---|---|
| 1.3±0.1g/cm3 (Cal.) | |
| Melting point | 65°C (Expl.) |
| Boiling point | 299.2±29.0°C at 760 mmHg (Cal.) |
| Flash point | 188.4±16.9°C (Cal.) |
| 112°C (Expl.) | |
| Safety Code | S26;S39 Details |
|---|---|
| Risk Code | R41 Details |
| Hazard Symbol |  X Details |
| Safety Description | Safety glasses and adequate ventilation. |
| WARNING: Irritates skin and eyes, harmful if swallowed | |
| Market Analysis Reports |
| List of Reports Available for Sulfolene |