Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6-Chloro-6-Deoxy-alpha-D-Glucopyranose |
|---|---|
| Synonyms | 6-Chloro-6-deoxy-α-d-glucopyranose |
| Molecular Structure |  |
| Molecular Formula | C6H11ClO5 |
| Molecular Weight | 198.60 |
| CAS Registry Number | 28528-86-1 |
| SMILES | ClC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | 1S/C6H11ClO5/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-6,8-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | QMWDIHPSUCUMFU-DVKNGEFBSA-N |
| Density | 1.685g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.751°C at 760 mmHg (Cal.) |
| Flash point | 187.096°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-6-Deoxy-alpha-D-Glucopyranose |