Online Database of Chemicals from Around the World
|
CAS#: 2859-55-4 Product: 4-[2-(4-Methoxyphenyl)Ethenyl]Quinoline No suppilers available for the product. |
| Name | 4-[2-(4-Methoxyphenyl)Ethenyl]Quinoline |
|---|---|
| Synonyms | 4-[2-(4-Methoxyphenyl)Ethenyl]Quinoline; 4-[(E)-2-(4-Methoxyphenyl)Vinyl]Quinoline; 4-[2-(4-Methoxyphenyl)Vinyl]Quinoline |
| Molecular Structure | ![CAS#: 2859-55-4， 4-[2-(4-Methoxyphenyl)Ethenyl]Quinoline](/moreStructures/2859-55-4.gif) |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 |
| CAS Registry Number | 2859-55-4 |
| SMILES | C1=CC=C2C(=C1)N=CC=C2\C=C\C3=CC=C(C=C3)OC |
| InChI | 1S/C18H15NO/c1-20-16-10-7-14(8-11-16)6-9-15-12-13-19-18-5-3-2-4-17(15)18/h2-13H,1H3/b9-6+ |
| InChIKey | WWQSNGMSYOYSOC-RMKNXTFCSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.361°C at 760 mmHg (Cal.) |
| Flash point | 159.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(4-Methoxyphenyl)Ethenyl]Quinoline |