Online Database of Chemicals from Around the World
| Name | 1H-Cyclopropa[b]Naphthalene |
|---|---|
| Synonyms | Inchi=1/C11h8/C1-2-4-9-6-11-7-10(11)5-8(9)3-1/H1-6H,7H; 1H-Cyclopropa(B)Naphthalene |
| Molecular Structure | ![CAS#: 286-85-1， 1H-Cyclopropa[b]Naphthalene](/moreStructures/286-85-1.gif) |
| Molecular Formula | C11H8 |
| Molecular Weight | 140.18 |
| CAS Registry Number | 286-85-1 |
| SMILES | C1=C3C(=CC2=C1C2)C=CC=C3 |
| InChI | 1S/C11H8/c1-2-4-9-6-11-7-10(11)5-8(9)3-1/h1-6H,7H2 |
| InChIKey | SHKRKDNBUOUWRB-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.568°C at 760 mmHg (Cal.) |
| Flash point | 127.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Cyclopropa[b]Naphthalene |
