Online Database of Chemicals from Around the World
|
CAS#: 28666-20-8 Product: Elsholtzidiol No suppilers available for the product. |
| Name | Elsholtzidiol |
|---|---|
| Synonyms | 3-Methyl-1-(3-Methyl-2-Furyl)Butane-2,3-Diol; 2,3-Butanediol, 3-Methyl-1-(3-Methyl-2-Furanyl)-; Elsholtzidiol |
| Molecular Structure |  |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 |
| CAS Registry Number | 28666-20-8 |
| SMILES | C1=CC(=C(CC(C(O)(C)C)O)O1)C |
| InChI | 1S/C10H16O3/c1-7-4-5-13-8(7)6-9(11)10(2,3)12/h4-5,9,11-12H,6H2,1-3H3 |
| InChIKey | GVWLWKOBGSTYTA-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.958°C at 760 mmHg (Cal.) |
| Flash point | 146.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Elsholtzidiol |