|
CAS#: 28692-35-5 Product: Lithium 2-(2,4-Dichlorophenoxy)Propionate No suppilers available for the product. |
| Name | Lithium 2-(2,4-Dichlorophenoxy)Propionate |
|---|---|
| Synonyms | Lithium 2-(2,4-Dichlorophenoxy)Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7Cl2LiO3 |
| Molecular Weight | 241.00 |
| CAS Registry Number | 28692-35-5 |
| EINECS | 249-160-5 |
| SMILES | C1=CC(=CC(=C1OC(C([O-])=O)C)Cl)Cl.[Li+] |
| InChI | 1S/C9H8Cl2O3.Li/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;/h2-5H,1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | PLCDUUDPVHWYKA-UHFFFAOYSA-M |
| Boiling point | 348.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium 2-(2,4-Dichlorophenoxy)Propionate |