Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
|
+91 (40) 6661-1133 | |||
|
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1-Methoxyphenazine |
|---|---|
| Synonyms | 1-Methoxyphenazine Methosulfate; Nsc 402756; Phenazine, 1-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23 |
| CAS Registry Number | 2876-17-7 |
| SMILES | C1=CC=C(OC)C2=C1N=C3C(=N2)C=CC=C3 |
| InChI | 1S/C13H10N2O/c1-16-12-8-4-7-11-13(12)15-10-6-3-2-5-9(10)14-11/h2-8H,1H3 |
| InChIKey | ZYDGCYWJDWIJCS-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Melting point | 171°C (Expl.) |
| Boiling point | 393.8°C at 760 mmHg (Cal.) |
| Flash point | 131.757°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Methoxyphenazine |