Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl [(1R,2R)-2-Acetylcyclopropyl]Acetate |
|---|---|
| Synonyms | methyl 2-((1R,2R)-2-acetylcyclopropyl)acetate |
| Molecular Structure | ![CAS#: 288153-50-4， Methyl [(1R,2R)-2-Acetylcyclopropyl]Acetate](/moreStructures/288153-50-4.gif) |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 |
| CAS Registry Number | 288153-50-4 |
| SMILES | O=C([C@H]1[C@@H](CC(=O)OC)C1)C |
| InChI | 1S/C8H12O3/c1-5(9)7-3-6(7)4-8(10)11-2/h6-7H,3-4H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | XPXUHZWUJJVCII-RQJHMYQMSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 209.438°C at 760 mmHg (Cal.) |
| Flash point | 82.54°C (Cal.) |
| Refractive index | 1.458 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl [(1R,2R)-2-Acetylcyclopropyl]Acetate |