Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6,7-Dichloro-2-Phenyl-4H-Chromen-4-One |
|---|---|
| Synonyms | 4H-1-Benzopyran-4-one, 6,7-dichloro-2-phenyl-; 4H-1-BENZOPYRAN-4-ONE,6,7-DICHLORO-2-PHENYL-; 6,7-Dichlor-2-phenyl-4H-chromen-4-on |
| Molecular Structure |  |
| Molecular Formula | C15H8Cl2O2 |
| Molecular Weight | 291.13 |
| CAS Registry Number | 288400-98-6 |
| SMILES | c1ccc(cc1)c2cc(=O)c3cc(c(cc3o2)Cl)Cl |
| InChI | 1S/C15H8Cl2O2/c16-11-6-10-13(18)8-14(9-4-2-1-3-5-9)19-15(10)7-12(11)17/h1-8H |
| InChIKey | ZHOKHUPIQOYNLF-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 189.4±27.7°C (Cal.) |
| Refractive index | 1.649 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dichloro-2-Phenyl-4H-Chromen-4-One |