|
CAS#: 28841-62-5 Product: Inositol 1,2,6-Triphosphate No suppilers available for the product. |
| Name | Inositol 1,2,6-Triphosphate |
|---|---|
| Synonyms | [(2R,3S,5R,6R)-3,4,5-Trihydroxy-2,6-Diphosphonooxy-Cyclohexyl] Dihydrogen Phosphate; Atrinositol; Atrinositol [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15O15P3 |
| Molecular Weight | 420.10 |
| CAS Registry Number | 28841-62-5 |
| SMILES | [C@H]1(O[P](O)(O)=O)C(O[P](O)(O)=O)[C@H](O[P](O)(O)=O)[C@@H](O)C(O)[C@H]1O |
| InChI | 1S/C6H15O15P3/c7-1-2(8)4(19-22(10,11)12)6(21-24(16,17)18)5(3(1)9)20-23(13,14)15/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1?,2-,3+,4-,5-,6?/m1/s1 |
| InChIKey | GKDKOMAJZATYAY-GCVPSNMTSA-N |
| Density | 2.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 839.154°C at 760 mmHg (Cal.) |
| Flash point | 461.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Inositol 1,2,6-Triphosphate |