Online Database of Chemicals from Around the World
| Name | Dibutyl Dihydrogen Diphosphate |
|---|---|
| Synonyms | (Butoxy-Hydroxy-Phosphoryl) Butyl Hydrogen Phosphate; Ai3-15047; Dibutyl Dihydrogen Diphosphate |
| Molecular Structure |  |
| Molecular Formula | C8H20O7P2 |
| Molecular Weight | 290.19 |
| CAS Registry Number | 28901-77-1 |
| EINECS | 249-299-1 |
| SMILES | C(O[P](O[P](OCCCC)(O)=O)(O)=O)CCC |
| InChI | 1S/C8H20O7P2/c1-3-5-7-13-16(9,10)15-17(11,12)14-8-6-4-2/h3-8H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | IIVCGGJCVPWXHR-UHFFFAOYSA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.02°C at 760 mmHg (Cal.) |
| Flash point | 188.468°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibutyl Dihydrogen Diphosphate |
