| Wuhan Xiju Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | xijubio.en.made-in-china.com | |||
![]() | +86 13043116031 | |||
![]() | Fan@wh-xiju.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | 7-bromo-5-phenyl-1,3-dihydro-2H-benzo[e][1,4]diazepin-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H11BrN2O |
| Molecular Weight | 315.16 |
| CAS Registry Number | 2894-61-3 |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=C3 |
| Solubility | 5.818 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.680, Calc.* |
| Melting point | 198.53 °C |
| Boiling Point | 469.87 °C, 464.8±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 234.9±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-bromo-5-phenyl-1,3-dihydro-2H-benzo[e][1,4]diazepin-2-one |