Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (E)-beta-Farnesene |
|---|---|
| Synonyms | (6Z)-7,11-Dimethyl-3-Methylene-Dodeca-1,6,10-Triene; (6Z)-7,11-Dimethyl-3-Methylenedodeca-1,6,10-Triene; (6Z)-7,11-Dimethyl-3-Methylidene-Dodeca-1,6,10-Triene |
| Molecular Structure |  |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 28973-97-9 |
| SMILES | C(\C(=C/CCC(C=C)=C)C)CC=C(C)C |
| InChI | 1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12- |
| InChIKey | JSNRRGGBADWTMC-QINSGFPZSA-N |
| Density | 0.808g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.499°C at 760 mmHg (Cal.) |
| Flash point | 109.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-beta-Farnesene |