Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3,5-Diamino-N-[(E)-Amino(Benzylamino)Methylene]-6-Chloro-2-Pyrazinecarboxamide |
|---|---|
| Synonyms | 2898-76-2 (HCL); 3,5-Diami |
| Molecular Structure | ![CAS#: 2898-76-2， 3,5-Diamino-N-[(E)-Amino(Benzylamino)Methylene]-6-Chloro-2-Pyrazinecarboxamide](/moreStructures/2898-76-2.gif) |
| Molecular Formula | C13H14ClN7O |
| Molecular Weight | 319.75 |
| CAS Registry Number | 2898-76-2 |
| SMILES | C1=CC=C(C=C1)CN/C(=N/C(=O)C2=C(N=C(C(=N2)Cl)N)N)/N |
| InChI | 1S/C13H14ClN7O/c14-9-11(16)20-10(15)8(19-9)12(22)21-13(17)18-6-7-4-2-1-3-5-7/h1-5H,6H2,(H4,15,16,20)(H3,17,18,21,22) |
| InChIKey | KXDROGADUISDGY-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 640.7±65.0°C at 760 mmHg (Cal.) |
| Flash point | 341.3±34.3°C (Cal.) |
| Refractive index | 1.738 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diamino-N-[(E)-Amino(Benzylamino)Methylene]-6-Chloro-2-Pyrazinecarboxamide |