Online Database of Chemicals from Around the World
| Name | 2,2,2-Trichloroacetophenone |
|---|---|
| Synonyms | 2,2,2-Trichloro-1-Phenyl-Ethanone; Ethanone, 1-Phenyl-, Trichloro Deriv.; Nsc23186 |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl3O |
| Molecular Weight | 223.49 |
| CAS Registry Number | 2902-69-4 |
| SMILES | C1=CC(=CC=C1)C(=O)C(Cl)(Cl)Cl |
| InChI | 1S/C8H5Cl3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-5H |
| InChIKey | OAMHTTBNEJBIKA-UHFFFAOYSA-N |
| Density | 1.44g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.382°C at 760 mmHg (Cal.) |
| Flash point | 104.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloroacetophenone |
