| Asinex Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Tris(2-Carboxyethyl) Isocyanurate |
|---|---|
| Synonyms | 3-[3,5-Bis(2-Carboxyethyl)-2,4,6-Triketo-1,3,5-Triazinan-1-Yl]Propionic Acid; Oprea1_280444; 3-[3,5-Bis-(2-Carboxy-Ethyl)-2,4,6-Trioxo-[1,3,5]Triazinan-1-Yl]-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O9 |
| Molecular Weight | 345.27 |
| CAS Registry Number | 2904-41-8 |
| EINECS | 220-803-1 |
| SMILES | C(N1C(N(C(=O)N(C1=O)CCC(O)=O)CCC(O)=O)=O)CC(O)=O |
| InChI | 1S/C12H15N3O9/c16-7(17)1-4-13-10(22)14(5-2-8(18)19)12(24)15(11(13)23)6-3-9(20)21/h1-6H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | HENCHDCLZDQGIQ-UHFFFAOYSA-N |
| Density | 1.604g/cm3 (Cal.) |
|---|---|
| Melting point | 228°C (Expl.) |
| Boiling point | 694.083°C at 760 mmHg (Cal.) |
| Flash point | 373.568°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Fangna Dai, Di Sun, Wenming Sun, Yun-Qi Liu and Daofeng Sun. Conformation variation of tris(2-carboxyethyl)isocyanuric acid induced by cocrystallized N-heterocyclic organic molecules, CrystEngComm, 2012, 14, 1376. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tris(2-Carboxyethyl) Isocyanurate |